CAS 57682-11-8

N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide

Description:

N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide, with the CAS number 57682-11-8, is a chemical compound characterized by its unique structure that includes an acetamide functional group and an epoxide moiety. This compound features a phenyl ring substituted with a methoxy group linked to an epoxide, which contributes to its reactivity and potential applications in organic synthesis. The presence of the epoxide group suggests that it may participate in nucleophilic reactions, making it useful in various chemical transformations. Additionally, the acetamide portion of the molecule may impart certain biological activities, potentially making it of interest in pharmaceutical research. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may exhibit specific interactions with biological targets. Overall, N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide represents a versatile structure that could be explored for various applications in medicinal chemistry and materials science.

Formula: C₁₁H₁₃NO₃

InChI: InChI=1/C11H13NO3/c1-8(13)12-10-4-2-3-5-11(10)15-7-9-6-14-9/h2-5,9H,6-7H2,1H3,(H,12,13)

SMILES: CC(=Nc1ccccc1OCC1CO1)O

Synonyms:

• N-[2-(oxiran-2-ylmethoxy)phenyl]acetamide

N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide

CAS: 57682-11-8

N1-[2-(oxiran-2-ylmethoxy)phenyl]acetamide

Purity: ≥95%

Ref: 54-OR28921

N-{2-[(oxiran-2-yl)methoxy]phenyl}acetamide

CAS: 57682-11-8

Formula: C₁₁H₁₃NO₃

Purity: 95.0%

Molecular weight: 207.229

Ref: 10-F521267