CAS 57684-30-7
:1-(1H-benzotriazol-1-yl)-N,N-dimethylmethanamine
Description:
1-(1H-benzotriazol-1-yl)-N,N-dimethylmethanamine, with the CAS number 57684-30-7, is an organic compound characterized by its unique structure that includes a benzotriazole moiety and a dimethylamino group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the benzotriazole group suggests that it may have applications in UV stabilization and as a corrosion inhibitor due to its ability to absorb UV light and form stable complexes with metal ions. Additionally, the dimethylamino group can impart basicity, influencing its reactivity and interaction with other chemical species. The compound may also exhibit biological activity, making it of interest in various fields, including materials science and pharmaceuticals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound's unique structural features contribute to its potential utility in diverse applications.
Formula:C9H12N4
InChI:InChI=1/C9H12N4/c1-12(2)7-13-9-6-4-3-5-8(9)10-11-13/h3-6H,7H2,1-2H3
SMILES:CN(C)Cn1c2ccccc2nn1
Synonyms:- 1H-1,2,3-benzotriazole-1-methanamine, N,N-dimethyl-
- N-(1H-1,2,3-benzotriazol-1-ylmethyl)-N,N-dimethylamine
- 1-(1H-Benzotriazol-1-yl)-N,N-dimethylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
