CAS 57688-34-3

4'-(Trifluoromethyl)biphenyl-4-amine

Description:

4'-(Trifluoromethyl)biphenyl-4-amine, with the CAS number 57688-34-3, is an organic compound characterized by its biphenyl structure substituted with a trifluoromethyl group and an amine functional group. This compound typically exhibits a high degree of lipophilicity due to the presence of the trifluoromethyl group, which can influence its solubility and reactivity. The amine group can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the trifluoromethyl group is known for enhancing the metabolic stability and bioactivity of organic molecules, which may be relevant in pharmaceutical applications. The compound's physical properties, such as melting point and boiling point, are influenced by its molecular structure and substituents. Overall, 4'-(Trifluoromethyl)biphenyl-4-amine is of interest in fields such as materials science and medicinal chemistry, where its unique properties can be exploited for developing new materials or therapeutic agents.

Formula: C₁₃H₁₀F₃N

InChI: InChI=1/C13H10F3N/c14-13(15,16)11-5-1-9(2-6-11)10-3-7-12(17)8-4-10/h1-8H,17H2

SMILES: c1cc(ccc1c1ccc(cc1)N)C(F)(F)F

Synonyms:

• [1,1'-Biphenyl]-4-amine, 4'-(trifluoromethyl)-
• 4'-(Trifluoromethyl)-biphenyl-4-amine

4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine, HCl

CAS: 57688-34-3

Formula: C₁₃H₁₀F₃N

Purity: 98%

Color and Shape: Solid

Molecular weight: 237.2204

Ref: IN-DA00376T

4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine

CAS: 57688-34-3

4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-amine

Purity: 98%

Molecular weight: 237.224g/mol

Ref: 54-PC103947

4′-Trifluoromethylbiphenyl-4-ylamine

CAS: 57688-34-3

Formula: C₁₃H₁₀F₃N

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.225

Ref: 10-F014365