CAS 57699-88-4
:benzyl tert-butyl hydrazine-1,2-dicarboxylate
Description:
Benzyl tert-butyl hydrazine-1,2-dicarboxylate, identified by its CAS number 57699-88-4, is a chemical compound that features a hydrazine moiety linked to a dicarboxylate structure. This compound typically exhibits characteristics common to hydrazine derivatives, such as potential reactivity due to the presence of the hydrazine functional group, which can participate in various chemical reactions, including condensation and oxidation. The tert-butyl group contributes to steric hindrance, potentially influencing the compound's reactivity and solubility in organic solvents. The benzyl group may enhance the lipophilicity of the molecule, making it more soluble in non-polar solvents. Additionally, the dicarboxylate portion can engage in hydrogen bonding and may serve as a site for further chemical modifications. Overall, this compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or agrochemicals, although specific applications would depend on its reactivity and biological properties. Safety and handling precautions should be observed due to the potential hazards associated with hydrazine derivatives.
Formula:C13H18N2O4
InChI:InChI=1/C13H18N2O4/c1-13(2,3)19-12(17)15-14-11(16)18-9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,14,16)(H,15,17)
SMILES:CC(C)(C)OC(=NN=C(O)OCc1ccccc1)O
Synonyms:- Benzyl tert-butyl hydrazine-1,2-dicarboxylate
- Hydrazine, N-BOC, N'-CBZ protected
- 1-Boc-2-Cbz-hydrazine
- 1-benzyl 2-(tert-butyl) 1,2-hydrazinedicarboxylate
- benzyl N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate
- 1-Benzyl 2-(tert-butyl) hydrazine-1,2-dicarboxylate
- N-Boc-N’-Cbz-hydrazine
- 1,2-Hydrazinedicarboxylic acid, 1-(1,1-diMethylethyl) 2-(phenylMethyl) ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Benzyl 2-(tert-butyl) 1,2-hydrazinedicarboxylate
CAS:Formula:C13H18N2O4Purity:97%Color and Shape:SolidMolecular weight:266.2930Hydrazine, N-BOC, N'-CBZ protected
CAS:Hydrazine, N-BOC, N'-CBZ protectedFormula:C13H18N2O4Purity:≥95%Color and Shape: white crystalline powderMolecular weight:266.29g/mol1-Benzyl 2-(tert-butyl) hydrazine-1,2-dicarboxylate
CAS:Formula:C13H18N2O4Purity:97%Color and Shape:SolidMolecular weight:266.297


