CAS 57699-89-5: 1-(1,1-Dimethylethyl) 2-(phenylmethyl) 1,2-pyrazolidinedicarboxylate

Description:1-(1,1-Dimethylethyl) 2-(phenylmethyl) 1,2-pyrazolidinedicarboxylate, with the CAS number 57699-89-5, is a chemical compound characterized by its pyrazolidine core structure, which features two carboxylate groups and substituents that enhance its reactivity and solubility. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of anti-inflammatory and analgesic agents. The presence of the bulky tert-butyl group (1,1-dimethylethyl) and the phenylmethyl group contributes to its steric properties, influencing its biological activity and interaction with various biological targets. Additionally, the compound's functional groups allow for various chemical modifications, making it a versatile scaffold in organic synthesis. Its stability and solubility in organic solvents further facilitate its use in laboratory settings. As with many pyrazolidine derivatives, it is essential to handle this compound with care, considering potential toxicity and safety protocols during experimentation.

Formula:C₁₆H₂₂N₂O₄

InChI:InChI=1S/C16H22N2O4/c1-16(2,3)22-15(20)18-11-7-10-17(18)14(19)21-12-13-8-5-4-6-9-13/h4-6,8-9H,7,10-12H2,1-3H3

InChI key:InChIKey=UVPBTBMYZNTBRY-UHFFFAOYSA-N

SMILES:O=C(OCC=1C=CC=CC1)N2N(C(=O)OC(C)(C)C)CCC2

Synonyms:
1,2-Pyrazolidinedicarboxylic acid, 1,1-dimethylethyl phenylmethyl ester
1-Benzyl 2-tert-butyl pyrazolidine-1,2-dicarboxylate
1,2-Pyrazolidinedicarboxylic acid, 1-(1,1-dimethylethyl) 2-(phenylmethyl) ester
1-(1,1-Dimethylethyl) 2-(phenylmethyl) 1,2-pyrazolidinedicarboxylate

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1,2-Pyrazolidinedicarboxylic acid, 1-(1,1-diMethylethyl) 2-(phenylMethyl) ester REF: IN-DA00F1DFCAS: 57699-89-5	95%	To inquire	Mon 14 Apr 25
Pyrazolidine-1,2-dicarboxylic acid 1-benzyl ester 2-tert-butyl ester REF: 10-F044806CAS: 57699-89-5	95.0%	To inquire	Thu 24 Apr 25
Pyrazolidine-1,2-dicarboxylic acid 1-benzyl ester 2-tert-butyl ester REF: 3D-HCA69989CAS: 57699-89-5	Min. 95%	- - -	Discontinued product