CAS 57704-10-6

(1S)-2-(tert-butylamino)-1-(7-ethylbenzofuran-2-yl)ethanol hydrochloride

Description:

(1S)-2-(tert-butylamino)-1-(7-ethylbenzofuran-2-yl)ethanol hydrochloride is a chemical compound characterized by its specific stereochemistry and functional groups. It features a tert-butylamino group, which contributes to its basicity and potential interactions with biological systems. The presence of the benzofuran moiety suggests that it may exhibit interesting pharmacological properties, as benzofurans are often associated with various biological activities. The hydrochloride salt form indicates that the compound is likely soluble in water, enhancing its bioavailability for potential therapeutic applications. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system or other biological pathways. Its structural complexity, including the ethyl substitution on the benzofuran, may influence its binding affinity and selectivity for specific receptors or enzymes. Overall, (1S)-2-(tert-butylamino)-1-(7-ethylbenzofuran-2-yl)ethanol hydrochloride represents a unique chemical entity with potential implications in pharmacology and medicinal research.

Formula: C₁₆H₂₄ClNO₂

InChI: InChI=1/C16H23NO2.ClH/c1-5-11-7-6-8-12-9-14(19-15(11)12)13(18)10-17-16(2,3)4;/h6-9,13,17-18H,5,10H2,1-4H3;1H/t13-;/m0./s1

SMILES: CCc1cccc2cc([C@H](CNC(C)(C)C)O)oc12.Cl

(S)-Bufuralol HCl

CAS: 57704-10-6

Formula: C₁₆H₂₃NO₂·HCl

Molecular weight: 261.37 36.46

Ref: 4Z-B-254

(S)-Bufuralol Hydrochloride

Controlled Product

CAS: 57704-10-6

Formula: C₁₆H₂₃NO₂·ClH

Color and Shape: Neat

Molecular weight: 297.82

Ref: TR-B689535

(S)-Bufuralol

CAS: 57704-10-6

Formula: C₁₆H₂₃NO₂HCl

Molecular weight: 261.37 : 36.46

Ref: ST-EA-CP-B139003