CymitQuimica logo

CAS 57704-16-2

:

1'-Hydroxybufuralol

Description:
1'-Hydroxybufuralol is a chemical compound that belongs to the class of beta-blockers, specifically a metabolite of bufuralol. It is characterized by the presence of a hydroxyl group (-OH) at the 1' position of the bufuralol structure, which contributes to its pharmacological properties. This compound exhibits selectivity for beta-adrenergic receptors, influencing cardiovascular functions such as heart rate and blood pressure. Its molecular structure includes a phenolic ring, which is typical of many beta-blockers, and it may also possess additional functional groups that enhance its biological activity. 1'-Hydroxybufuralol is primarily studied for its role in pharmacokinetics and metabolism, as well as its potential therapeutic effects in treating conditions like hypertension and arrhythmias. The compound is typically analyzed using techniques such as chromatography and mass spectrometry to determine its concentration and effects in biological systems. As with many pharmaceuticals, understanding its safety profile and potential side effects is crucial for its application in clinical settings.
Formula:C16H23NO3
InChI:InChI=1/C16H23NO3/c1-10(18)12-7-5-6-11-8-14(20-15(11)12)13(19)9-17-16(2,3)4/h5-8,10,13,17-19H,9H2,1-4H3
SMILES:CC(c1cccc2cc(C(CNC(C)(C)C)O)oc12)O
Synonyms:
  • 2-(tert-Butylamino)-1-[7-(1-hydroxyethyl)-1-benzofuran-2-yl]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.