CAS 57709-61-2

1,10-Phenanthroline-2,9-dicarboxylic acid

Description:

1,10-Phenanthroline-2,9-dicarboxylic acid is an organic compound characterized by its structure, which features a phenanthroline backbone with two carboxylic acid groups located at the 2 and 9 positions. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional groups. It exhibits chelating properties, allowing it to form stable complexes with various metal ions, which makes it useful in analytical chemistry and biochemistry, particularly in the detection and quantification of metal ions. The compound may also display fluorescence properties, which can be leveraged in various applications, including sensors and probes. Additionally, its ability to participate in hydrogen bonding and π-π stacking interactions contributes to its potential utility in materials science and supramolecular chemistry. Overall, 1,10-Phenanthroline-2,9-dicarboxylic acid is a versatile compound with significant applications in both research and industry.

Formula: C₁₄H₆N₂O₄

InChI: InChI=1/C14H8N2O4/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9/h1-6H,(H,17,18)(H,19,20)/p-2

SMILES: c1cc2ccc(C(=O)[O-])nc2c2c1ccc(C(=O)[O-])n2

Synonyms:

• 1,10-Phenanthroline-2,9-Dicarboxylate
• 1,10-Phenanthroline-2,9-dicarboxylic acid HYDRATE

1,10-Phenanthroline-2,9-dicarboxylic acid

CAS: 57709-61-2

Formula: C₁₄H₈N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 268.228

Ref: 10-F325010

1,10-Phenanthroline-2,9-dicarboxylic acid hydrate, 97%

CAS: 57709-61-2

1,10-Phenanthroline-2,9-dicarboxylic acid hydrate is used to produce 1,10-phenanthroline-2,9-dicarbonyl chloride. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origi

Formula: C₁₄H₈N₂O₄

Purity: 97%

Color and Shape: White to cream to pale green, Powder

Molecular weight: 268.23

Ref: 02-A18548

1,10-Phenanthroline-2,9-dicarboxylic acid

CAS: 57709-61-2

Formula: C₁₄H₈N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 268.2243

Ref: IN-DA003D7A

1,10-Phenanthroline-2,9-dicarboxylic acid

CAS: 57709-61-2

1,10-Phenanthroline-2,9-dicarboxylic acid

Purity: 97%

Molecular weight: 268.23g/mol

Ref: 54-OR75300