CAS 5771-32-4

4-amino-N-[3-(morpholin-4-yl)propyl]-1,2,5-oxadiazole-3-carboxamide

Description:

4-amino-N-[3-(morpholin-4-yl)propyl]-1,2,5-oxadiazole-3-carboxamide, with the CAS number 5771-32-4, is a chemical compound characterized by its oxadiazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a morpholine moiety indicates that it may exhibit interesting pharmacological properties, as morpholines are often found in various pharmaceuticals due to their ability to interact with biological targets. The compound is likely to be soluble in polar solvents, given the presence of the carboxamide and amino groups, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activity, toxicity, and stability would require further investigation through experimental studies.

Formula: C₇H₁₀O

InChI: InChI=1/C7H10O/c8-6-2-1-3-7(6)4-5-7/h1-5H2

SMILES: C(CN=C(c1c(N)non1)O)CN1CCOCC1

Synonyms:

• 1,2,5-oxadiazole-3-carboxamide, 4-amino-N-[3-(4-morpholinyl)propyl]-
• Spiro[2.4]heptan-4-one
• spiro[2.4]heptan-7-one

Spiro[2.4]heptan-4-one

CAS: 5771-32-4

Spiro[2.4]heptan-4-one

Purity: 97%

Molecular weight: 110.156g/mol

Ref: 54-OR73008

SPIRO[2.4]HEPTAN-4-ONE

CAS: 5771-32-4

Formula: C₇H₁₀O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 110.156

Ref: 10-F529454