CAS 57712-59-1

1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile

Description:

1-Isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile, with the CAS number 57712-59-1, is a heterocyclic organic compound characterized by its pyrimidine ring structure. This compound features a dioxo functional group, which contributes to its reactivity and potential biological activity. The presence of the isopropyl group enhances its lipophilicity, potentially influencing its solubility and interaction with biological membranes. The carbonitrile group introduces a polar functional group, which can participate in hydrogen bonding and may affect the compound's overall polarity and reactivity. This compound is of interest in medicinal chemistry due to its structural features, which may exhibit various pharmacological properties. Its synthesis typically involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental conditions such as pH and temperature.

Formula: C₈H₉N₃O₂

InChI: InChI=1/C8H9N3O2/c1-5(2)11-4-6(3-9)7(12)10-8(11)13/h4-5H,1-2H3,(H,10,12,13)

SMILES: CC(C)n1cc(C#N)c(nc1=O)O

Synonyms:

• 1-(1-Methylethyl)-2,4-Dioxo-1,2,3,4-Tetrahydropyrimidine-5-Carbonitrile

1-Isopropyluracil-5-carbonitrile

CAS: 57712-59-1

1-Isopropyluracil-5-carbonitrile

Purity: ≥95%

Color and Shape: White Solid

Molecular weight: 179.18g/mol

Ref: 54-OR25579