
CAS 57734-56-2
:5-(Aminosulfonyl)-2-methoxy-N-(2-pyrrolidinylmethyl)benzamide
Description:
5-(Aminosulfonyl)-2-methoxy-N-(2-pyrrolidinylmethyl)benzamide, with the CAS number 57734-56-2, is a chemical compound that belongs to the class of sulfonamides. It features a benzamide structure, which is characterized by the presence of a benzene ring attached to a carbonyl group (C=O) and an amine group (NH2) that is further substituted with a sulfonyl group (SO2). The compound also contains a methoxy group (-OCH3) and a pyrrolidinylmethyl substituent, which contributes to its potential biological activity. This compound may exhibit properties such as solubility in polar solvents and moderate stability under standard conditions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through experimental studies. As with any chemical substance, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C13H19N3O4S
InChI:InChI=1S/C13H19N3O4S/c1-20-12-5-4-10(21(14,18)19)7-11(12)13(17)16-8-9-3-2-6-15-9/h4-5,7,9,15H,2-3,6,8H2,1H3,(H,16,17)(H2,14,18,19)
InChI key:InChIKey=XUWYBISTYZABLV-UHFFFAOYSA-N
SMILES:C(NCC1CCCN1)(=O)C2=C(OC)C=CC(S(N)(=O)=O)=C2
Synonyms:- Benzamide, 5-(aminosulfonyl)-2-methoxy-N-(2-pyrrolidinylmethyl)-
- 2-Methoxy-N-[(pyrrolidin-2-yl)methyl]-5-sulfamoylbenzamide
- N-Desethylsulpiride
- 5-(Aminosulfonyl)-2-methoxy-N-(2-pyrrolidinylmethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
