CAS 57744-69-1
:(5Z)-4-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methylene]-2(5H)-furanone
Description:
The chemical substance known as (5Z)-4-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methylene]-2(5H)-furanone, with the CAS number 57744-69-1, is a complex organic compound characterized by its furanone structure, which features a furan ring fused with a carbonyl group. This compound exhibits multiple hydroxyl groups, contributing to its potential as a phenolic antioxidant. The presence of the 3-methyl-2-buten-1-yl substituents indicates that it may possess significant biological activity, possibly influencing its reactivity and interactions in various chemical environments. Its structural features suggest potential applications in pharmaceuticals, food chemistry, or as a natural product, given its antioxidant properties. The compound's stability, solubility, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other reactants. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C27H28O5
InChI:InChI=1S/C27H28O5/c1-16(2)5-8-19-13-18(7-11-22(19)28)14-24-26(30)25(27(31)32-24)21-10-12-23(29)20(15-21)9-6-17(3)4/h5-7,10-15,28-30H,8-9H2,1-4H3/b24-14-
InChI key:InChIKey=LFDYHAWYVIBCDT-OYKKKHCWSA-N
SMILES:OC\1=C(C(=O)O/C1=C\C2=CC(CC=C(C)C)=C(O)C=C2)C3=CC(CC=C(C)C)=C(O)C=C3
Synonyms:- 2(5H)-Furanone, 4-hydroxy-3-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]methylene]-, (Z)-
- 2(5H)-Furanone, 4-hydroxy-3-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]methylene]-, (5Z)-
- 2(5H)-Furanone, 4-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methylene]-, (5Z)-
- (5Z)-4-Hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-5-[[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]methylene]-2(5H)-furanone
- Aspulvinone H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Aspulvinone H
CAS:Aspulvinone H inhibits GOT1, hampers glutamine metabolism, sensitizes PDAC cells to oxidative stress, and has strong antitumor effects in vivo.Formula:C27H28O5Color and Shape:SolidMolecular weight:432.51
