CAS 5775-33-7
:N-chloro-N-ethylethanamine
Description:
N-chloro-N-ethylethanamine, with the CAS number 5775-33-7, is an organic compound characterized by the presence of both a chloro group and an ethylamine moiety. This substance typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. It has a relatively low boiling point and is soluble in organic solvents, making it useful in various chemical applications. The compound is often utilized in the synthesis of other chemicals, particularly in the production of pharmaceuticals and agrochemicals. Safety considerations are important when handling N-chloro-N-ethylethanamine, as it may pose health risks through inhalation or skin contact, and appropriate precautions should be taken to minimize exposure. Overall, its unique structure and reactivity make it a valuable compound in organic synthesis and industrial applications.
Formula:C4H10ClN
InChI:InChI=1/C4H10ClN/c1-3-6(5)4-2/h3-4H2,1-2H3
SMILES:CCN(CC)Cl
Synonyms:- Ethanamine, N-chloro-N-ethyl-
- N-Chloro-N-ethylethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.