CAS 57750-82-0

4-Fluoro-2-nitrobenzoyl chloride

Description:

4-Fluoro-2-nitrobenzoyl chloride is an organic compound characterized by the presence of both a fluoro and a nitro group on a benzoyl chloride structure. Its molecular formula is C7H4ClFNO3, indicating the presence of chlorine, fluorine, nitrogen, and oxygen in addition to carbon and hydrogen. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The nitro group contributes to its electrophilic properties, enhancing its utility in nucleophilic substitution reactions. Additionally, 4-Fluoro-2-nitrobenzoyl chloride is sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding carboxylic acid. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its potential hazards.

Formula: C₇H₃ClFNO₃

InChI: InChI=1S/C7H3ClFNO3/c8-7(11)5-2-1-4(9)3-6(5)10(12)13/h1-3H

InChI key: InChIKey=NQMGZEFEQXWOAT-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=C(N(=O)=O)C=C(F)C=C1

Synonyms:

• Benzoyl chloride, 4-fluoro-2-nitro-
• 4-Fluoro-2-nitrobenzoyl chloride

4-Fluoro-2-nitrobenzoyl chloride

CAS: 57750-82-0

Versatile small molecule scaffold

Formula: C₇H₃ClFNO₃

Purity: Min. 95%

Molecular weight: 203.55 g/mol

Ref: 3D-HCA75082