CAS 5776-28-3
:4-hydroxyquinoline-6-carboxylic acid
Description:
4-Hydroxyquinoline-6-carboxylic acid, with the CAS number 5776-28-3, is an organic compound that features a quinoline structure, which is a bicyclic aromatic compound. This substance is characterized by the presence of a hydroxyl group (-OH) at the 4-position and a carboxylic acid group (-COOH) at the 6-position of the quinoline ring. It typically appears as a solid and is soluble in polar solvents, reflecting its functional groups' ability to engage in hydrogen bonding. The compound exhibits various chemical properties, including the potential to act as a chelating agent, which allows it to form complexes with metal ions. This characteristic makes it useful in various applications, including analytical chemistry and biochemistry. Additionally, 4-hydroxyquinoline-6-carboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features contribute to its reactivity and interactions in different chemical environments, highlighting its significance in both synthetic and applied chemistry contexts.
Formula:C10H7NO3
InChI:InChI=1/C10H7NO3/c12-9-3-4-11-8-2-1-6(10(13)14)5-7(8)9/h1-5H,(H,11,12)(H,13,14)
SMILES:c1cc2c(cc1C(=O)O)c(=O)cc[nH]2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
8-Hydroxynaphthalene-2-Carboxylic Acid
CAS:8-Hydroxynaphthalene-2-carboxylic acid (8HNCA) is a synthetic, quinolinecarboxylic acid that is coexpressed with indole-3-carboxylic acid in the coelenterate Hydra. 8HNCA can be hydroxylated to produce 8-hydroxyquinoline carboxylic acid, which is a substrate for putidaredoxin reductase and also has monooxygenase activity. The enzyme encoded by the reductase gene catalyzes the conversion of 8HNCA into 2,4-dihydroxyphenylacetic acid, which is an intermediate in tyrosine synthesis. The enzyme encoded by the carboxylic acids sequence oxidizes 8HNCA to form 5,6-dihydroindole-2-carboxylic acid.Formula:C11H8O3Purity:Min. 95%Molecular weight:188.18 g/mol
