CAS 57764-60-0

N-(chloroacetyl)-4-methoxybenzamide

Description:

N-(Chloroacetyl)-4-methoxybenzamide, with the CAS number 57764-60-0, is a chemical compound characterized by its structural features, which include a chloroacetyl group and a methoxy-substituted aromatic ring. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the chloroacetyl moiety suggests reactivity that may be exploited in various chemical reactions, such as acylation or nucleophilic substitution. The methoxy group enhances the compound's lipophilicity and may influence its biological activity. Additionally, the compound's properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards, as compounds containing halogens and amides can exhibit toxicity or reactivity under certain conditions. Overall, N-(chloroacetyl)-4-methoxybenzamide represents a versatile structure in organic synthesis and pharmaceutical research.

Formula: C₁₀H₁₀ClNO₃

InChI: InChI=1/C10H10ClNO3/c1-15-8-4-2-7(3-5-8)10(14)12-9(13)6-11/h2-5H,6H2,1H3,(H,12,13,14)

SMILES: COc1ccc(cc1)C(=O)N=C(CCl)O

Synonyms:

• N-(2-Chloro-acetyl)-4-methoxy-benzamide

N-(2-Chloroacetyl)-4-methoxybenzamide

CAS: 57764-60-0

Versatile small molecule scaffold

Formula: C₁₀H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 227.64 g/mol

Ref: 3D-HCA76460