CAS 57768-94-2: Pentanoic acid, 2-hydroxy-, sodium salt (1:1)

Description:Pentanoic acid, 2-hydroxy-, sodium salt (1:1), also known as sodium 2-hydroxypentanoate, is a sodium salt derived from pentanoic acid, which is a straight-chain carboxylic acid. This compound features a hydroxyl group (-OH) at the second carbon of the pentanoic acid chain, imparting it with both acidic and alcohol characteristics. As a sodium salt, it is typically soluble in water, making it useful in various applications, including as a buffering agent or in biochemical processes. The presence of the hydroxyl group enhances its reactivity and potential for forming hydrogen bonds, which can influence its solubility and interaction with other substances. This compound may be utilized in food, pharmaceuticals, or cosmetic formulations due to its mild properties. Additionally, it is important to handle it with care, as with any chemical substance, to ensure safety and compliance with relevant regulations. Overall, pentanoic acid, 2-hydroxy-, sodium salt is a versatile compound with applications in multiple fields.

Formula:C₅H₁₀O₃·Na

InChI:InChI=1S/C5H10O3.Na/c1-2-3-4(6)5(7)8;/h4,6H,2-3H2,1H3,(H,7,8);

InChI key:InChIKey=WRAMQASELVSGEO-UHFFFAOYSA-N

SMILES:[Na].O=C(O)C(O)CCC