CymitQuimica logo

CAS 577691-56-6

:

tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate

Description:
Tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate is a chemical compound characterized by its piperidine ring structure, which includes a fluorine atom and an amino group at specific positions. The compound features a tert-butyl ester functional group, contributing to its solubility and stability. The stereochemistry indicated by the (3S,4R) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's biological activity and interactions. This compound is often of interest in medicinal chemistry due to its potential applications in drug development, particularly in the design of pharmaceuticals targeting various biological pathways. Its properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the functional groups present. Additionally, the presence of the amino and fluorine substituents may enhance its reactivity and selectivity in chemical reactions. Overall, tert-butyl (3S,4R)-4-amino-3-fluoropiperidine-1-carboxylate represents a versatile scaffold for further chemical modifications and applications in research and industry.
Formula:C10H19FN2O2
InChI:InChI=1/C10H19FN2O2/c1-10(2,3)15-9(14)13-5-4-8(12)7(11)6-13/h7-8H,4-6,12H2,1-3H3/t7-,8+/m0/s1
InChI key:ZQRYPCAUVKVMLZ-JGVFFNPUSA-N
SMILES:CC(C)(C)OC(=O)N1CC[C@H]([C@H](C1)F)N
Synonyms:
  • Cis-4-Amino-1-Boc-3-Fluoropiperidine
Found 4 products.