CAS 57773-65-6
:Deslelin
Description:
Deslelin, with the CAS number 57773-65-6, is a chemical compound that belongs to the class of substances known as neuropeptides. It is primarily recognized for its role in pharmacological applications, particularly in the modulation of neurotransmitter activity. Deslelin is characterized by its specific amino acid sequence, which contributes to its biological activity and interaction with receptors in the nervous system. The compound is often studied for its potential therapeutic effects, including its influence on pain perception and mood regulation. In terms of physical properties, Deslelin is typically a white to off-white powder, soluble in water, and stable under standard laboratory conditions. Its synthesis and characterization involve various analytical techniques, including chromatography and mass spectrometry, to ensure purity and confirm its structural integrity. As with many neuropeptides, research into Deslelin continues to explore its mechanisms of action and potential applications in treating neurological disorders.
Formula:C66H87N17O14
InChI:InChI=1/C64H83N17O12.C2H4O2/c1-4-68-62(92)53-16-10-24-81(53)63(93)46(15-9-23-69-64(65)66)74-56(86)47(25-35(2)3)75-58(88)49(27-37-30-70-43-13-7-5-11-41(37)43)77-57(87)48(26-36-17-19-40(83)20-18-36)76-61(91)52(33-82)80-59(89)50(28-38-31-71-44-14-8-6-12-42(38)44)78-60(90)51(29-39-32-67-34-72-39)79-55(85)45-21-22-54(84)73-45;1-2(3)4/h5-8,11-14,17-20,30-32,34-35,45-53,70-71,82-83H,4,9-10,15-16,21-29,33H2,1-3H3,(H,67,72)(H,68,92)(H,73,84)(H,74,86)(H,75,88)(H,76,91)(H,77,87)(H,78,90)(H,79,85)(H,80,89)(H4,65,66,69);1H3,(H,3,4)/t45-,46-,47-,48-,49+,50-,51-,52-,53-;/m0./s1
Synonyms:- (Des-Gly10,D-Trp6,Pro-NHEt9)-LHRH
- Pyr-His-Trp-Ser-Tyr-D-Trp-Leu-Arg-Pro-NHEt
- Deslorelin
- [D- Trp6 ,Des-Gly10 ]-Lh-Rh Ethylamide
- 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide acetate
- des-gly10,(D-trp6)luteinizing hormone*releasing H
- Desloreline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(Des-Gly¹⁰,D-Trp⁶,Pro-NHEt⁹)-LHRH High acetate salt
CAS:Short-term administration of deslorelin stimulates the formation of LH and FSH, which induce an increase in the production of testosterone and estradiol. Prolonged administration of the GnRH agonist causes a sustained down-regulation of circulating LH and FSH levels and hence suppression of steroidogenesis.Formula:C64H83N17O12Purity:99.1%Color and Shape:WhitishMolecular weight:1282.47Deslorellin acetate
CAS:Formula:C64H83N17O12Purity:≥ 90.0%Color and Shape:White to off-white powderMolecular weight:1282.45Deslorelin Acetate
CAS:Formula:C64H83N17O12Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:1282.45Deslorelin
CAS:DeslorelinPurity:Greater than 99.0% as determined by(a) analysis by rp-hplc. (Typical Value in Batch COA)Color and Shape: sterile filtered white lyophilized (freeze-dried) powderMolecular weight:1,282.45g/molDeslorelin
CAS:Deslorelin is a hormone that belongs to the class of gonadotropin-releasing hormone analogs. It is used to induce ovulation and as a contraceptive in humans. Deslorelin binds to receptors on the surface of cells in the pituitary gland and inhibits secretion of follicle-stimulating hormone (FSH) and luteinizing hormone (LH). This causes an inhibition of ovarian activity, which leads to the cessation of ovulation. Deslorelin also has been shown to be effective in reducing autoimmune diseases, such as systemic lupus erythematosus, by inhibiting production of antibodies against basic fibroblast antigen.
Formula:C64H83N17O12Purity:Min. 95%Color and Shape:PowderMolecular weight:1,282.45 g/mol1-9-Luteinizing hormone-releasing factor (swine),6-D-tryptophan-9-(N-ethyl-L-prolinamide)-
CAS:Formula:C64H83N17O12Purity:98%Molecular weight:1282.4505Ref: IN-DA019FVI
Discontinued product







