CAS 57775-08-3

3-(4-Bromophenyl)propionitrile

Description:

3-(4-Bromophenyl)propionitrile, with the CAS number 57775-08-3, is an organic compound characterized by its propionitrile backbone substituted with a 4-bromophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It features a nitrile functional group (-C≡N), which imparts notable polarity and reactivity, making it useful in various chemical syntheses. The presence of the bromine atom enhances its electrophilic character, allowing for further functionalization in organic reactions. This compound is often utilized in pharmaceutical and agrochemical research due to its potential as an intermediate in the synthesis of biologically active molecules. Additionally, its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be observed when handling this compound, as it may pose health risks associated with brominated compounds and nitriles.

Formula: C₉H₈BrN

InChI: InChI=1/C9H8BrN/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6H,1-2H2

SMILES: C(Cc1ccc(cc1)Br)C#N

Synonyms:

• 3-(4-Bromophenyl)Propanenitrile

3-(4-BROMOPHENYL)PROPIONITRILE

CAS: 57775-08-3

Formula: C₉H₈BrN

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.0705

Ref: IN-DA00EA1W

3-(4-Bromophenyl)propanenitrile

CAS: 57775-08-3

3-(4-Bromophenyl)propanenitrile

Purity: 95%

Molecular weight: 210.07g/mol

Ref: 54-OR3087

3-(4-Bromophenyl)propionitrile

CAS: 57775-08-3

Formula: C₉H₈BrN

Purity: 98%

Color and Shape: Liquid

Molecular weight: 210.074

Ref: 10-F018025