CymitQuimica logo

CAS 57775-25-4

:

2,5-dihydroxybenzene-1,4-disulfonic acid - N-ethylethanamine (1:2)

Description:
2,5-Dihydroxybenzene-1,4-disulfonic acid, also known as N-ethylethanamine (1:2), is a chemical compound characterized by its sulfonic acid groups and hydroxyl functionalities, which contribute to its solubility in water and potential reactivity. The presence of two hydroxyl groups on the benzene ring enhances its ability to form hydrogen bonds, making it a polar compound. The disulfonic acid groups provide strong acidic properties, allowing it to act as a strong acid in aqueous solutions. This compound is often used in various applications, including as a dye intermediate, in pharmaceuticals, and in the synthesis of other chemical compounds. Its structure suggests that it may participate in various chemical reactions, including sulfonation and esterification. Additionally, the presence of the N-ethylethanamine moiety indicates potential for interactions with biological systems, which may be relevant in medicinal chemistry. Overall, this compound's unique combination of functional groups makes it versatile in both industrial and research settings.
Formula:C14H28N2O8S2
InChI:InChI=1/C6H6O8S2.2C4H11N/c7-3-1-5(15(9,10)11)4(8)2-6(3)16(12,13)14;2*1-3-5-4-2/h1-2,7-8H,(H,9,10,11)(H,12,13,14);2*5H,3-4H2,1-2H3
SMILES:c1c(c(cc(c1S(=O)(=O)O)O)S(=O)(=O)O)O.CCNCC.CCNCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.