CAS 5778-47-2

7-methoxy-1,3,4,10-tetrahydroacridin-9(2H)-one

Description:

7-Methoxy-1,3,4,10-tetrahydroacridin-9(2H)-one, with the CAS number 5778-47-2, is a chemical compound that belongs to the class of acridine derivatives. This substance is characterized by its unique bicyclic structure, which includes a methoxy group at the 7-position and a carbonyl group at the 9-position, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in organic solvents. The compound has garnered interest in medicinal chemistry due to its potential neuroprotective properties and its role in the development of treatments for neurodegenerative diseases. Its structure allows for interactions with various biological targets, making it a subject of research in pharmacology. Additionally, the presence of the methoxy group can influence its lipophilicity and overall pharmacokinetic profile. As with many organic compounds, its stability, reactivity, and biological effects can be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₄H₁₅NO₂

InChI: InChI=1/C14H15NO2/c1-17-9-6-7-13-11(8-9)14(16)10-4-2-3-5-12(10)15-13/h6-8H,2-5H2,1H3,(H,15,16)

SMILES: COc1ccc2c(c1)c(=O)c1CCCCc1[nH]2

7-Methoxy-1,2,3,4,9,10-hexahydroacridin-9-one

CAS: 5778-47-2

Versatile small molecule scaffold

Formula: C₁₄H₁₅NO₂

Purity: Min. 95%

Molecular weight: 229.27 g/mol

Ref: 3D-FAA77847