CAS 57783-66-1
:(6R,8S,8aR)-6,7,8-tribenzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine
Description:
The chemical substance known as "(6R,8S,8aR)-6,7,8-tribenzyloxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine" with the CAS number 57783-66-1 is a complex organic compound characterized by its unique bicyclic structure, which incorporates a dioxine moiety and multiple benzyl ether functionalities. This compound exhibits chirality, indicated by its specific stereochemical configuration at several carbon centers, which can influence its biological activity and interactions. The presence of phenyl and benzyloxy groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis. Its structural features may confer specific solubility properties and reactivity patterns, making it of interest in various chemical research fields. Additionally, the compound's stability and behavior under different conditions would be essential for understanding its practical applications and potential toxicity. Overall, this substance represents a fascinating example of synthetic organic chemistry with implications in both academic research and industrial applications.
Formula:C34H34O6
InChI:InChI=1/C34H34O6/c1-5-13-25(14-6-1)21-35-31-30-29(24-38-33(40-30)28-19-11-4-12-20-28)39-34(37-23-27-17-9-3-10-18-27)32(31)36-22-26-15-7-2-8-16-26/h1-20,29-34H,21-24H2/t29?,30-,31+,32?,33?,34-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside
CAS:<p>Benzyl 2,3-di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside</p>Molecular weight:538.63016g/molBenzyl 2,3-Di-O-benzyl-4,6-O-benzylidene-β-D-glucopyranoside
CAS:Controlled ProductFormula:C34H34O6Color and Shape:NeatMolecular weight:538.631,2,3-Tri-O-benzyl-4,6-O-benzylidene-b-D-glucopyranoside
CAS:<p>1,2,3-Tri-O-benzyl-4,6-O-benzylidene-b-D-glucopyranoside is a triol with an O benzyl group on C1. It is a synthetic modification of the sugar glucose and has been used as a building block for the synthesis of glycosides and oligosaccharides. 1,2,3-Tri-O-benzyl-4,6-O-benzylideneb -D -glucopyranoside can be used in methylation reactions to produce saccharides with methyl groups at positions that are not normally present. <br>This product is highly pure and can be used in Click chemistry reactions to modify oligosaccharides. This product does not have an CAS number listed.</p>Formula:C34H34O6Purity:Min. 95%Molecular weight:538.63 g/mol



