CAS 57783-76-3
:[(3R,4S,5R,6S)-3,4,5,6-tetrabenzyloxytetrahydropyran-2-yl]methanol
Description:
The chemical substance known as [(3R,4S,5R,6S)-3,4,5,6-tetrabenzyloxytetrahydropyran-2-yl]methanol, with the CAS number 57783-76-3, is a complex organic compound characterized by its tetrabenzyloxy-substituted tetrahydropyran structure. This compound features a pyran ring, which is a six-membered ring containing one oxygen atom, and is further substituted with four benzyloxy groups, enhancing its lipophilicity and potentially influencing its reactivity and solubility in organic solvents. The presence of a hydroxymethyl group contributes to its functionality, allowing for potential interactions in various chemical reactions. The stereochemistry indicated by the (3R,4S,5R,6S) configuration suggests specific spatial arrangements of the substituents, which can significantly affect the compound's biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and organic synthesis due to their structural complexity and potential applications in drug development or as intermediates in synthetic pathways.
Formula:C34H36O6
InChI:InChI=1/C34H36O6/c35-21-30-31(36-22-26-13-5-1-6-14-26)32(37-23-27-15-7-2-8-16-27)33(38-24-28-17-9-3-10-18-28)34(40-30)39-25-29-19-11-4-12-20-29/h1-20,30-35H,21-25H2/t30?,31-,32+,33-,34+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
BENZYL 2,3,4-TRI-O-BENZYL-α-D-MANNOPYRANOSIDE
CAS:Formula:C34H36O6Purity:97%Color and Shape:LiquidMolecular weight:540.6460Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside
CAS:<p>Benzyl 2,3,4-tri-O-benzyl-α-D-mannopyranoside</p>Purity:>98%Color and Shape:OilMolecular weight:510.62g/mol1,2,3,4-Tetra-O-benzyl-α-D-mannopyranoside
CAS:<p>1,2,3,4-Tetra-O-benzyl-a-D-mannopyranoside is an active drug that belongs to the group of thyromimetics. It is a prodrug that is hydrolyzed in vivo to 1,2,3,4-tetra-O-acetyl-a-D-mannopyranose. This drug has been shown to be effective in treating nervous system diseases such as sclerosis and endogenous disease. The acetylation of the benzyl group on this molecule prevents it from being metabolized by enzymes that are found in the liver. The unmodified form of this drug is rapidly absorbed into the blood and reaches high concentrations quickly.</p>Formula:C34H36O6Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:540.65 g/molBenzyl 2,3,4-Tri-O-benzyl-α-D-mannopyranoside
CAS:Controlled Product<p>Applications Benzyl 2,3,4-Tri-O-benzyl-α-D-mannopyranoside (cas# 57783-76-3) is a compound useful in organic synthesis.<br>References Huang, B., et al.: Bioorg. Med. Chem. Lett., 7, 1157 (1997),<br></p>Formula:C33H34O5Color and Shape:NeatMolecular weight:510.62




