CAS 5779-54-4
:1,1-Cyclopentanedimethanol, 1,1-bis(phenylcarbamate)
Description:
1,1-Cyclopentanedimethanol, 1,1-bis(phenylcarbamate) is a chemical compound characterized by its unique structure, which includes a cyclopentane ring with two hydroxymethyl groups and two phenyl carbamate moieties. This compound typically exhibits properties associated with both alcohols and carbamates, such as potential solubility in organic solvents and the ability to form hydrogen bonds due to the presence of hydroxyl groups. The phenyl carbamate groups contribute to its reactivity, making it useful in various applications, including as a potential intermediate in organic synthesis or in polymer chemistry. The presence of multiple functional groups allows for diverse chemical reactivity, including esterification and nucleophilic substitution reactions. Additionally, the compound may exhibit moderate to low toxicity, typical of many carbamate derivatives, and should be handled with appropriate safety precautions. Its specific applications and behavior in different environments can vary, depending on the conditions and the presence of other reactants or solvents.
Formula:C21H24N2O4
InChI:InChI=1S/C21H24N2O4/c24-19(22-17-9-3-1-4-10-17)26-15-21(13-7-8-14-21)16-27-20(25)23-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,22,24)(H,23,25)
InChI key:InChIKey=IRZVVDMCEZNNCW-UHFFFAOYSA-N
SMILES:C(OC(NC1=CC=CC=C1)=O)C2(COC(NC3=CC=CC=C3)=O)CCCC2
Synonyms:- 1,1-Cyclopentanedimethanol, 1,1-bis(phenylcarbamate)
- 1,1-Cyclopentanedimethanol, dicarbanilate
- Calmalone
- 1,1-Cyclopentanedimethanol, bis(phenylcarbamate)
- Cyclarbamate
- cyclopentane-1,1-diyldimethanediyl bis(phenylcarbamate)
- cyclopentylidenedimethyl dicarbanilate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclarbamate
CAS:Cyclarbamate is a muscle relaxant and a sedative.Formula:C21H24N2O4Color and Shape:SolidMolecular weight:368.43
