CAS 577967-68-1

2-Chloro-7-fluoro-6-methoxyquinoline

Description:

2-Chloro-7-fluoro-6-methoxyquinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of chlorine and fluorine substituents at the 2 and 7 positions, respectively, along with a methoxy group at the 6 position, contributes to its unique chemical properties. This compound is typically a pale yellow solid and is soluble in organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen atoms can influence its reactivity and interaction with biological targets. Additionally, the methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetics. As with many quinoline derivatives, it may also possess antimicrobial or antimalarial properties, although specific biological activities would need to be confirmed through experimental studies. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₇ClFNO

InChI: InChI=1S/C10H7ClFNO/c1-14-9-4-6-2-3-10(11)13-8(6)5-7(9)12/h2-5H,1H3

InChI key: InChIKey=KXIUJIPISYINBN-UHFFFAOYSA-N

SMILES: O(C)C1=CC2=C(C=C1F)N=C(Cl)C=C2

Synonyms:

• Quinoline, 2-chloro-7-fluoro-6-methoxy-
• 2-Chloro-7-fluoro-6-methoxyquinoline

2-Chloro-7-fluoro-6-methoxyquinoline

CAS: 577967-68-1

Versatile small molecule scaffold

Formula: C₁₀H₇ClFNO

Purity: Min. 95%

Molecular weight: 211.62 g/mol

Ref: 3D-CYA96768