
CAS 578-06-3
:1-Acridinamine
Description:
1-Acridinamine, with the CAS number 578-06-3, is an organic compound characterized by its acridine backbone, which is a tricyclic structure composed of fused benzene and pyridine rings. This compound typically appears as a yellow to orange crystalline solid and is known for its potential biological activity, particularly in the field of medicinal chemistry. 1-Acridinamine can exhibit properties such as fluorescence, making it useful in various analytical applications. It is often studied for its role as a potential antitumor agent due to its ability to intercalate DNA, which can disrupt cellular processes. Additionally, it may possess antimicrobial properties. The compound is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and application in pharmaceutical formulations. Safety data indicates that, like many acridine derivatives, it should be handled with care due to potential toxicity. Overall, 1-acridinamine is a compound of interest in both synthetic and medicinal chemistry, warranting further investigation into its properties and applications.
Formula:C13H10N2
InChI:InChI=1S/C13H10N2/c14-11-5-3-7-13-10(11)8-9-4-1-2-6-12(9)15-13/h1-8H,14H2
InChI key:InChIKey=LOMMDWBTANPFEJ-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=C3C(=C2)C=CC=C3)C=CC1
Synonyms:- NSC 170666
- Acridine, 1-amino-
- 1-Aminoacridine
- 1-Acridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Acridinamine
CAS:<p>1-Acridinamine is a biochemical.</p>Formula:C13H10N2Color and Shape:SolidMolecular weight:194.23
