CAS 578-85-8
:1-Naphthol-3,6-disulfonic acid
Description:
1-Naphthol-3,6-disulfonic acid, with the CAS number 578-85-8, is an organic compound characterized by its sulfonic acid functional groups attached to a naphthalene ring. This compound features two sulfonic acid groups located at the 3 and 6 positions of the naphthalene structure, which significantly enhances its solubility in water and contributes to its acidic properties. It is typically a white to light yellow crystalline solid and is known for its use as a dye intermediate and in various chemical syntheses. The presence of multiple sulfonic acid groups makes it a strong acid, and it can participate in various chemical reactions, including electrophilic substitutions. Additionally, 1-naphthol-3,6-disulfonic acid is utilized in the production of azo dyes and as a reagent in analytical chemistry. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes. Overall, its unique structure and properties make it valuable in industrial applications and research.
Formula:C10H8O7S2
InChI:InChI=1S/C10H8O7S2/c11-10-5-8(19(15,16)17)4-6-3-7(18(12,13)14)1-2-9(6)10/h1-5,11H,(H,12,13,14)(H,15,16,17)
InChI key:InChIKey=TZBROGJRQUABOK-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(S(=O)(=O)O)C1)C=C(S(=O)(=O)O)C=C2
Synonyms:- 1-Hydroxy-3,6-naphthalenedisulfonic acid
- 1-Naphthol, 3,6-disulfo-
- 2,7-Naphthalenedisulfonic acid, 4-hydroxy-
- 3,6-Disulfo-1-naphthol
- 4-Hydroxy-2,7-naphthalenedisulfonic acid
- 4-Hydroxynaphthalene-2,7-disulphonic acid
- Bgo 136
- Nsc 8627
- Violet acid
- 1-Naphthol-3,6-disulfonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Hydroxynaphthalene-2,7-disulphonic acid
CAS:4-Hydroxynaphthalene-2,7-disulphonic acid is a metal chelate with bidentate ligands. It has been shown to be effective for the removal of heavy metals from wastewater. 4-Hydroxynaphthalene-2,7-disulphonic acid binds to metal ions and forms a stable chelate ring. This process can be enhanced by hydration or redox conditions. The stability of the chelate ring is increased by the presence of an adjacent hydroxy group, which can undergo reductive elimination to form water molecules. 4-Hydroxynaphthalene-2,7-disulphonic acid is used in titration methods for determining metal ion concentration in solution.Formula:C10H8O7S2Purity:Min. 95%Color and Shape:PowderMolecular weight:304.3 g/mol
