CymitQuimica logo

CAS 57800-65-4

:

(3-methoxyphenyl)(2-methylphenyl)methanone

Description:
(3-Methoxyphenyl)(2-methylphenyl)methanone, with the CAS number 57800-65-4, is an organic compound characterized by its ketone functional group, specifically a methanone structure where two aromatic rings are substituted. The presence of a methoxy group (-OCH3) on the 3-position of one phenyl ring and a methyl group (-CH3) on the 2-position of the other phenyl ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. Its molecular structure suggests potential applications in organic synthesis, pharmaceuticals, and as a building block in various chemical reactions. The presence of substituents can influence its reactivity, stability, and interaction with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H14O2
InChI:InChI=1/C15H14O2/c1-11-6-3-4-9-14(11)15(16)12-7-5-8-13(10-12)17-2/h3-10H,1-2H3
SMILES:Cc1ccccc1C(=O)c1cccc(c1)OC
Found 2 products.