CAS 57800-77-8

2-Chloro-5-(methylsulfonyl)-3-nitrothiophene

Description:

2-Chloro-5-(methylsulfonyl)-3-nitrothiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a chlorine atom at the 2-position, a nitro group at the 3-position, and a methylsulfonyl group at the 5-position of the thiophene ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chlorine atom can participate in nucleophilic substitution reactions, while the nitro group can serve as an electron-withdrawing group, influencing the compound's reactivity and stability. The methylsulfonyl group enhances the solubility of the compound in polar solvents and may also affect its biological activity. Overall, 2-Chloro-5-(methylsulfonyl)-3-nitrothiophene exhibits unique properties due to its structural features, making it of interest for further research and development in synthetic chemistry.

Formula: C₅H₄ClNO₄S₂

InChI: InChI=1S/C5H4ClNO4S2/c1-13(10,11)4-2-3(7(8)9)5(6)12-4/h2H,1H3

InChI key: InChIKey=YOKQNIITLXOXNG-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC(N(=O)=O)=C(Cl)S1

Synonyms:

• Thiophene, 2-chloro-5-(methylsulfonyl)-3-nitro-
• 2-Chloro-5-(methylsulfonyl)-3-nitrothiophene
• 2-Chloro-5-methanesulfonyl-3-nitrothiophene

2-Chloro-5-methanesulfonyl-3-nitrothiophene

CAS: 57800-77-8

Versatile small molecule scaffold

Formula: C₅H₄ClNO₄S₂

Purity: Min. 95%

Molecular weight: 241.7 g/mol

Ref: 3D-HCA80077