CymitQuimica logo

CAS 57803-07-3

:

3-formyl-6,7-dimethylchromone

Description:
3-Formyl-6,7-dimethylchromone is an organic compound belonging to the chromone family, characterized by a chromone backbone with specific substituents. It features a formyl group (-CHO) at the 3-position and two methyl groups at the 6 and 7 positions of the chromone ring. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant and antimicrobial properties. The presence of the formyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and nucleophilic addition. Additionally, 3-formyl-6,7-dimethylchromone can serve as a precursor for the synthesis of more complex organic molecules. Its solubility is generally influenced by the polarity of the substituents, and it may dissolve in organic solvents like ethanol or dichloromethane. The compound's unique structure and functional groups make it of interest in medicinal chemistry and materials science, where it may be explored for applications in drug development and organic synthesis.
Formula:C12H10O3
InChI:InChI=1S/C12H10O3/c1-7-3-10-11(4-8(7)2)15-6-9(5-13)12(10)14/h3-6H,1-2H3
InChI key:XDRXIOAFMFRNOJ-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1C)OC=C(C2=O)C=O
Found 4 products.