CAS 57804-27-0
:Benzene,[[(2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl]thio]-
Description:
The chemical substance known as Benzene, [[(2E,6E,10E)-3,7,11,15-tetramethyl-2,6,10,14-hexadecatetraenyl]thio]- (CAS number 57804-27-0) is a complex organic compound characterized by its aromatic benzene ring structure, which is substituted with a thioether group. This compound features a long hydrocarbon chain with multiple double bonds, indicated by the "tetramethyl" and "hexadecatetraenyl" descriptors, suggesting a high degree of unsaturation and branching. The presence of the thioether functional group introduces sulfur into the molecular structure, which can influence the compound's reactivity and solubility. Such compounds are often studied for their potential applications in organic synthesis, materials science, and as intermediates in the production of various chemicals. The specific stereochemistry denoted by the E configuration indicates the arrangement of substituents around the double bonds, which can significantly affect the compound's physical and chemical properties. Overall, this substance exemplifies the complexity and diversity of organic molecules, particularly those derived from natural sources or designed for specific functionalities.
Formula:C26H38S
InChI:InChI=1S/C26H38S/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26-18-7-6-8-19-26/h6-8,12,14,16,18-20H,9-11,13,15,17,21H2,1-5H3/b23-14+,24-16+,25-20+
InChI key:InChIKey=MYTISHNKWOCLGO-GHDNBGIDSA-N
SMILES:S(C/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)C1=CC=CC=C1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Geranylgeranyl Phenyl Sulfide
CAS:Controlled ProductApplications Used in the preparation of coenzymes Q, vitamin K and polyprenylquinones.
References Naruta, Y. et al.: J. Org. Chem., 45, 4097 (1980)Formula:C26H38SColor and Shape:NeatMolecular weight:382.645
