CAS 57818-36-7
:12,15-Epoxy-13,14-dimethyleicosa-12,14-dienoic acid
Description:
12,15-Epoxy-13,14-dimethyleicosa-12,14-dienoic acid, with CAS number 57818-36-7, is a chemical compound characterized by its unique structure, which includes an epoxy group and multiple double bonds within a long-chain fatty acid framework. This compound is part of the class of polyunsaturated fatty acids and is notable for its potential biological activities, including anti-inflammatory properties. The presence of the epoxy group suggests that it may participate in various chemical reactions, making it a subject of interest in organic synthesis and biochemistry. Its long carbon chain contributes to its hydrophobic nature, influencing its solubility and interaction with biological membranes. Additionally, the specific arrangement of methyl groups and double bonds can affect its reactivity and stability, as well as its role in metabolic pathways. Overall, this compound exemplifies the complexity and diversity of fatty acid derivatives, with implications for both research and potential applications in pharmaceuticals and nutrition.
Formula:C22H38O3
InChI:InChI=1S/C22H38O3/c1-4-5-12-15-20-18(2)19(3)21(25-20)16-13-10-8-6-7-9-11-14-17-22(23)24/h4-17H2,1-3H3,(H,23,24)
InChI key:InChIKey=MCTXSZNBSIMKTO-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCC(O)=O)C=1OC(CCCCC)=C(C)C1C
Synonyms:- 3,4-Dimethyl-5-pentyl-2-furanundecanoic acid
- 11D5
- 2-Furanundecanoic acid, 3,4-dimethyl-5-pentyl-
- 11-(3,4-Dimethyl-5-pentylfuran-2-yl)undecanoic acid
- 12,15-Epoxy-13,14-dimethyleicosa-12,14-dienoic acid
- 12,15-epoxy-13,14-dimethyl-12,14-Eicosadienoic acid
- Furan Fatty Acid F6
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4-dimethyl-5-pentyl-2-furanundecanoic acid
CAS:Formula:C22H38O3Purity:>95%Color and Shape:In solution, EthanolMolecular weight:350.543,4-Dimethyl-5-pentyl-2-furanundecanoic Acid
CAS:Controlled Product<p>Stability Light Sensitive, Temperature Sensitive<br>Applications 3,4-Dimethyl-5-pentyl-2-furanundecanoic acid is also known as F6 furan fatty acid. Furan fatty acids are generated in large amounts in algae and fish, but they are also produced by plants and microorganisms. Furan fatty acids are known to exhibit radical-scavenging ability and anti-inflammatory properties.<br>References Grahl, N., et al.: Marine. Biol., 157, 1567 (2010); Spiteller, G., et al.: Lipids., 40, 75 (2005); Wakimoto, T., et al.: PNSA., 108, 17533 (2011);<br></p>Formula:C22H38O3Color and Shape:NeatMolecular weight:350.54


