CAS 57818-37-8
:12,15-Epoxy-13-methyleicosa-12,14-dienoic acid
Description:
12,15-Epoxy-13-methyleicosa-12,14-dienoic acid, with the CAS number 57818-37-8, is a chemical compound characterized by its unique structure, which includes an epoxy group and multiple double bonds within a long-chain fatty acid framework. This compound is part of the class of polyunsaturated fatty acids and is notable for its potential biological activities, including anti-inflammatory properties. The presence of the epoxy group suggests that it may participate in various chemical reactions, making it a subject of interest in organic synthesis and biochemistry. Its long carbon chain contributes to its hydrophobic nature, influencing its solubility and interaction with biological membranes. Additionally, the specific positioning of the double bonds and the epoxy group can affect its reactivity and stability, which are critical factors in its applications in research and potential therapeutic uses. Overall, this compound exemplifies the complexity and diversity of fatty acid derivatives in chemical and biological contexts.
Formula:C21H36O3
InChI:InChI=1S/C21H36O3/c1-3-4-11-14-19-17-18(2)20(24-19)15-12-9-7-5-6-8-10-13-16-21(22)23/h17H,3-16H2,1-2H3,(H,22,23)
InChI key:InChIKey=QDTBMEGPXZUECM-UHFFFAOYSA-N
SMILES:C(CCCC)C=1OC(CCCCCCCCCCC(O)=O)=C(C)C1
Synonyms:- 2-Furanundecanoic acid, 3-methyl-5-pentyl-
- 11-(3-Methyl-5-pentylfuran-2-yl)undecanoic acid
- 3-Methyl-5-pentyl-2-furanundecanoic acid
- 12,15-Epoxy-13-methyleicosa-12,14-dienoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methyl-5-pentyl-2-furanundecanoic Acid
CAS:Formula:C21H36O3Purity:98%Color and Shape:SolidMolecular weight:336.508712,15-epoxy-13-methyleicosa-12,14-dienoic acid
CAS:Formula:C21H36O3Purity:>95%Color and Shape:SolidMolecular weight:336.513-Methyl-5-pentyl-2-furanundecanoic Acid
CAS:Controlled ProductApplications 3-Methyl-5-pentyl-2-furanundecanoic Acid is also known as F5 furan fatty acid. Furan fatty acids are generated in large amounts in algae and fish, but they are also produced by plants and microorganisms. Furan fatty acids are known to exhibit radical-scavenging ability and anti-inflammatory properties.
References Alberti, F., et al.: Prog. Nut., 11, 154 (2009); Spiteller, G., et al.: Lipids., 40, 75 (2005); Wakimoto, T., et al.: PNSA., 108, 17533 (2011);Formula:C21H36O3Color and Shape:NeatMolecular weight:336.5112,15-epoxy-13-methyl-12,14-Eicosadienoic Acid
CAS:12,15-Epoxy-13-methyl-12,14-eicosadienoic acid, a furan fatty acid first identified in northern pike (E. lucius), exhibits elevated levels in the liver of starving cod.Formula:C21H36O3Color and Shape:SolidMolecular weight:336.51




