CAS 57822-06-7
:5-Oxoazelaic acid
Description:
5-Oxoazelaic acid, with the CAS number 57822-06-7, is a dicarboxylic acid characterized by its unique structure, which includes a five-membered ring containing a ketone functional group. This compound is a derivative of azelaic acid, featuring an additional carbonyl group at the fifth position. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to its carboxylic acid groups. The presence of both carboxylic acid and ketone functionalities allows for various chemical reactivity, making it useful in organic synthesis and potential applications in pharmaceuticals and agrochemicals. Additionally, 5-oxoazelaic acid may exhibit biological activity, which can be explored for therapeutic purposes. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, 5-oxoazelaic acid is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C9H14O5
InChI:InChI=1S/C9H14O5/c10-7(3-1-5-8(11)12)4-2-6-9(13)14/h1-6H2,(H,11,12)(H,13,14)
InChI key:InChIKey=GTCHZEFRDKAINX-UHFFFAOYSA-N
SMILES:C(CCCC(O)=O)(CCCC(O)=O)=O
Synonyms:- 5-Oxononanedioic acid
- NSC 134496
- Nonanedioic acid, 5-oxo-
- Nsc 111667
- 5-Oxoazelaic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Oxoazelaic Acid
CAS:Formula:C9H14O5Purity:>96.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:202.215-Oxoazelaic acid
CAS:5-Oxoazelaic acid is a stable organic compound that belongs to the class of organic acids. It is a symmetrical molecule with two carbon atoms and four oxygen atoms. The chemical stability of 5-Oxoazelaic acid is due to the carbonyl group in its structure, which can react with electrophilic compounds such as water, alcohols and amines. 5-Oxoazelaic acid has been shown to be more reactive than a fatty acid because it can lose a hydrogen atom from the carbonyl group when reacting with an electrophile, while fatty acids cannot. 5-Oxoazelaic acid is produced by the oxidation of undecane, which is an anthropogenic product.Formula:C9H14O5Purity:Min. 95%Molecular weight:202.2 g/mol




