CAS 57830-29-2

3-[2-(dimethylamino)ethyl]-4-[(pyridin-2-ylamino)methyl]phenol

Description:

3-[2-(Dimethylamino)ethyl]-4-[(pyridin-2-ylamino)methyl]phenol, with the CAS number 57830-29-2, is a chemical compound characterized by its complex structure that includes a phenolic core substituted with both a dimethylaminoethyl group and a pyridin-2-ylaminomethyl group. This compound typically exhibits properties associated with both amines and phenols, such as potential basicity due to the presence of the dimethylamino group and the ability to participate in hydrogen bonding due to the hydroxyl group. It may also display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the pyridine ring can contribute to its lipophilicity and influence its interaction with biological targets. Additionally, the compound's solubility, stability, and reactivity can vary depending on the pH and the presence of other functional groups in the environment. Overall, this compound's unique structural features suggest potential applications in drug development and other chemical research areas.

Formula: C₁₆H₂₁N₃O

InChI: InChI=1/C16H21N3O/c1-19(2)10-8-13-11-15(20)7-6-14(13)12-18-16-5-3-4-9-17-16/h3-7,9,11,20H,8,10,12H2,1-2H3,(H,17,18)

SMILES: CN(C)CCc1cc(ccc1CNc1ccccn1)O

O-Desmethyl Mepyramine

CAS: 57830-29-2

Formula: C₁₆H₂₁N₃O

Molecular weight: 271.36

Ref: 4Z-M-179005

O-Desmethyl Pyrilamine

Controlled Product

CAS: 57830-29-2

Applications A metabolite of the antihistamine Pyrilamine.
References Chung, B.C., et al.: Xenobiotica, 24, 451 (1994),

Formula: C₁₆H₂₁N₃O

Color and Shape: Neat

Molecular weight: 271.36

Ref: TR-D292195

O-Desmethyl pyrilamine

CAS: 57830-29-2

Please enquire for more information about O-Desmethyl pyrilamine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₆H₂₁N₃O

Purity: Min. 95%

Molecular weight: 271.36 g/mol

Ref: 3D-FD21312

O-Desmethyl Pyrilamine

CAS: 57830-29-2

Formula: C₁₆H₂₁N₃O

Molecular weight: 271.36

Ref: ST-EA-CP-M63006