CAS 5786-77-6
:N,N-dimethyl-4,4-di(thiophen-2-yl)but-3-en-2-aminium chloride
Description:
N,N-Dimethyl-4,4-di(thiophen-2-yl)but-3-en-2-aminium chloride is a quaternary ammonium compound characterized by its unique structure, which includes a butenyl backbone substituted with two thiophene rings and a dimethylamino group. This compound typically exhibits properties associated with ionic liquids, such as low volatility and high thermal stability. Its quaternary ammonium nature imparts cationic characteristics, making it soluble in polar solvents and potentially useful in various applications, including organic electronics, photonic devices, and as a surfactant. The presence of thiophene moieties contributes to its electronic properties, enhancing conductivity and enabling interactions with other organic materials. Additionally, the chloride ion serves as a counterion, influencing the solubility and stability of the compound in different environments. Overall, N,N-dimethyl-4,4-di(thiophen-2-yl)but-3-en-2-aminium chloride is notable for its potential in advanced materials science and organic synthesis.
Formula:C14H18ClNS2
InChI:InChI=1/C14H17NS2.ClH/c1-11(15(2)3)10-12(13-6-4-8-16-13)14-7-5-9-17-14;/h4-11H,1-3H3;1H
SMILES:CC(C=C(c1cccs1)c1cccs1)N(C)C.Cl
Synonyms:- 3-buten-2-amine, N,N-dimethyl-4,4-di-2-thienyl-, hydrochloride (1:1)
- N,N-Dimethyl-4,4-di(2-thienyl)but-3-en-2-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dimethylthiambutene Hydrochloride
CAS:Controlled ProductApplications An opioid analgesic drug used in veterinary medicine.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Iwata, N. et al.: Jap. J. Pharmacol., 21, 427 (1971);Formula:C14H18ClNS2Color and Shape:NeatMolecular weight:299.88Dimethylthiambutene hydrochloride
CAS:Controlled ProductPlease enquire for more information about Dimethylthiambutene hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C14H18ClNS2Purity:Min. 95%Molecular weight:299.88 g/mol

