CAS 57865-92-6
:methyl 3-(acetylamino)-4-O-benzoyl-6-bromo-2,3,6-trideoxyhexopyranoside
Description:
Methyl 3-(acetylamino)-4-O-benzoyl-6-bromo-2,3,6-trideoxyhexopyranoside, with the CAS number 57865-92-6, is a complex organic compound characterized by its structural features that include a hexopyranoside backbone, acetylamino and benzoyl functional groups, and a bromine substituent. This compound is part of the class of trideoxy sugars, which are sugars that lack hydroxyl groups at specific positions, contributing to their unique reactivity and properties. The presence of the acetylamino group suggests potential for interactions in biological systems, while the benzoyl group can enhance lipophilicity, affecting solubility and permeability. The bromine atom introduces a halogen, which can influence the compound's reactivity and stability. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of glycosylated drugs or as intermediates in organic synthesis. Overall, the specific arrangement of functional groups and the sugar moiety contribute to the compound's chemical behavior and potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C16H20BrNO5
InChI:InChI=1/C16H20BrNO5/c1-10(19)18-12-8-14(21-2)22-13(9-17)15(12)23-16(20)11-6-4-3-5-7-11/h3-7,12-15H,8-9H2,1-2H3,(H,18,19)/t12-,13?,14-,15-/m0/s1
SMILES:CC(=N[C@H]1C[C@@H](OC)OC(CBr)[C@H]1OC(=O)c1ccccc1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3-Acetylamino-4-O-benzoyl-6-bromo-2,3,6-trideoxy-α-D-ribo-hexopyranoside
CAS:Molecular weight:386.24Methyl 3-acetamido-4-O-benzoyl-6-bromo-2,3,6-trideoxy-a-D-ribo-hexopyranoside
CAS:<p>Methyl 3-acetamido-4-O-benzoyl-6-bromo-2,3,6-trideoxy--aDribohexopyranoside is a Custom synthesis that is classified as an Oligosaccharide. It has a molecular weight of 576.07 and a purity of >99%. The chemical formula for this compound is C22H30BrNO8. Methyl 3-acetamido-4-O-benzoyl-6-bromo-2,3,6--trideoxy--aDribohexopyranoside is used in the modification of saccharides with the purpose of synthesizing polysaccharides. This compound has been shown to be effective for the synthesis of glycosylations and methylations.<br>Methyl 3 acetamido 4 O benzoyl 6 bromo 2,3,6 trideoxy - a D rib</p>Formula:C16H20BrNO5Purity:Min. 95%Molecular weight:386.25 g/mol

