
CAS 5787-28-0
:(+)-2-Phenylbutane
Description:
(+)-2-Phenylbutane, with the CAS number 5787-28-0, is an organic compound characterized by its structure, which features a butane backbone with a phenyl group attached to the second carbon. This compound is a chiral molecule, meaning it exists in two enantiomeric forms, with the (+) designation indicating its specific optical activity. It is a colorless liquid at room temperature and is known for its pleasant aromatic odor. The compound is relatively non-polar, making it soluble in organic solvents but less so in water. Its boiling point and melting point are typical for hydrocarbons of similar structure, and it is stable under standard conditions. (+)-2-Phenylbutane is often used in organic synthesis and as a building block in the production of various chemical compounds. Additionally, it may have applications in the fragrance industry due to its aromatic properties. Safety data indicates that, while it is generally considered low in toxicity, appropriate handling and safety measures should be observed to avoid potential hazards.
Formula:C10H14
InChI:InChI=1S/C10H14/c1-3-9(2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3/t9-/m0/s1
InChI key:InChIKey=ZJMWRROPUADPEA-VIFPVBQESA-N
SMILES:[C@@H](CC)(C)C1=CC=CC=C1
Synonyms:- d-sec-Butylbenzene
- [(1S)-1-Methylpropyl]benzene
- Benzene, [(1S)-1-methylpropyl]-
- Benzene, sec-butyl-, (S)-(+)-
- Benzene, (1-methylpropyl)-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.