CAS 5787-71-3
:2-(dimethylamino)acetohydrazide dihydrochloride (non-preferred name)
Description:
2-(Dimethylamino)acetohydrazide dihydrochloride, with the CAS number 5787-71-3, is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with an acetic acid derivative. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride form, which enhances its ionic character. It is often used in organic synthesis and may serve as a reagent in various chemical reactions, including those involving hydrazones or amidines. The presence of the dimethylamino group contributes to its basicity and potential reactivity, making it useful in medicinal chemistry and the development of pharmaceuticals. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, 2-(dimethylamino)acetohydrazide dihydrochloride is a versatile compound with applications in research and industry, particularly in the synthesis of more complex organic molecules.
Formula:C4H13Cl2N3O
InChI:InChI=1/C4H11N3O.2ClH/c1-7(2)3-4(8)6-5;;/h3,5H2,1-2H3,(H,6,8);2*1H
SMILES:CN(C)CC(=NN)O.Cl.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Girard's Reagent D
CAS:Formula:C4H11N3O·2HClPurity:>99.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:190.07Glycine, N,N-dimethyl-, hydrazide, dihydrochloride
CAS:Formula:C4H13Cl2N3OPurity:98%Color and Shape:SolidMolecular weight:190.07152-(Dimethylamino)acetohydrazide dihydrochloride
CAS:Purity:95.0%Color and Shape:Solid, White - Almost white powderMolecular weight:190.07000732421875Dimethylaminoacetic acid hydrazide dihydrochloride
CAS:Please enquire for more information about Dimethylaminoacetic acid hydrazide dihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pagePurity:Min. 95%




