CAS 578715-23-8

2-[5-(5-bromo-2-thienyl)-2-thienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[5-(5-bromo-2-thienyl)-2-thienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and thienyl groups. The presence of bromine in the thienyl moiety enhances its reactivity and potential applications in organic synthesis and materials science. This compound is typically used in cross-coupling reactions, particularly in the formation of carbon-carbon bonds, making it valuable in the synthesis of complex organic molecules. The dioxaborolane structure contributes to its stability and solubility in organic solvents, which is advantageous for various chemical reactions. Additionally, the tetramethyl substitution on the boron atom provides steric hindrance, influencing its reactivity profile. Overall, this compound exemplifies the versatility of boron compounds in organic chemistry, particularly in the development of new synthetic methodologies and functional materials. Its specific applications may vary based on ongoing research and advancements in the field.

Formula: C₁₄H₁₆BBrO₂S₂

InChI: InChI=1/C14H16BBrO2S2/c1-13(2)14(3,4)18-15(17-13)11-7-5-9(19-11)10-6-8-12(16)20-10/h5-8H,1-4H3

SMILES: CC1(C)C(C)(C)OB(c2ccc(c3ccc(Br)s3)s2)O1

5'-Bromo-2,2'-bithiophene-5-boronic acid pinacol ester

CAS: 578715-23-8

Formula: C₁₄H₁₆BBrO₂S₂

Molecular weight: 371.1206

Ref: IN-DA003EXR

2-(5′-Bromo-[2,2′-bithiophen]-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 578715-23-8

Formula: C₁₄H₁₆BBrO₂S₂

Purity: 95.0%

Molecular weight: 371.11

Ref: 10-F228991