
CAS 57884-84-1
:S-Aristeromycinyl-L-homocysteine
Description:
S-Aristeromycinyl-L-homocysteine, with the CAS number 57884-84-1, is a chemical compound that belongs to the class of nucleoside analogs. It is characterized by the presence of a homocysteine moiety, which is an amino acid that plays a crucial role in various metabolic processes. This compound is notable for its potential biological activities, particularly in the context of antiviral and anticancer research. The structure of S-Aristeromycinyl-L-homocysteine features a modified ribonucleoside backbone, which may enhance its stability and efficacy compared to natural nucleosides. Its unique configuration allows it to interact with biological targets, potentially inhibiting viral replication or modulating cellular pathways. As with many nucleoside analogs, the pharmacological properties of S-Aristeromycinyl-L-homocysteine are of significant interest, and ongoing studies may reveal its therapeutic potential in various medical applications. However, detailed studies on its toxicity, bioavailability, and specific mechanisms of action are essential for understanding its full profile in medicinal chemistry.
Formula:C15H22N6O4S
InChI:InChI=1S/C15H22N6O4S/c16-8(15(24)25)1-2-26-4-7-3-9(12(23)11(7)22)21-6-20-10-13(17)18-5-19-14(10)21/h5-9,11-12,22-23H,1-4,16H2,(H,24,25)(H2,17,18,19)/t7-,8+,9-,11-,12+/m1/s1
InChI key:InChIKey=MZBVTOOFTWJQRK-YYTHCXKUSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(N)N=CN3)C[C@H](CSCC[C@@H](C(O)=O)N)[C@H]1O
Synonyms:- L-Homocysteine, S-[[4-(6-amino-9H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl]-, [1S-(1α,2β,3β,4α)]-
- S-Aristeromycinyl-L-homocysteine
- S-[[(1S,2R,3S,4R)-4-(6-Amino-9H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl]-L-homocysteine
- L-Homocysteine, S-[[(1S,2R,3S,4R)-4-(6-amino-9H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-Aristeromycinylhomocysteine
CAS:S-Aristeromycinylhomocysteine is an inhibitor of adenosylmethionine decarboxylase.Formula:C15H22N6O4SColor and Shape:SolidMolecular weight:382.44
