CAS 579-21-5
:Lobelanine
Description:
Lobelanine, with the CAS number 579-21-5, is an alkaloid derived from the plant Lobelia inflata, commonly known as Indian tobacco. This compound is characterized by its structural features, which include a bicyclic framework typical of many alkaloids. Lobelanine exhibits a range of biological activities, including potential effects on the central nervous system, where it may act as a stimulant or depressant depending on the dosage and context. It has been studied for its pharmacological properties, including its potential use in respiratory therapies due to its bronchodilator effects. Additionally, lobelanine has been investigated for its role in traditional medicine, although its use is limited due to toxicity concerns at higher doses. The compound is typically encountered in a crystalline form and is soluble in organic solvents. As with many alkaloids, caution is advised in handling and usage due to its bioactive nature and potential side effects.
Formula:C22H25NO2
InChI:InChI=1/C22H25NO2/c1-23-19(15-21(24)17-9-4-2-5-10-17)13-8-14-20(23)16-22(25)18-11-6-3-7-12-18/h2-7,9-12,19-20H,8,13-16H2,1H3/t19-,20+
InChI key:InChIKey=IDEMKXUAULKYJV-BGYRXZFFNA-N
SMILES:C(C(=O)C1=CC=CC=C1)[C@H]2N(C)[C@@H](CC(=O)C3=CC=CC=C3)CCC2
Synonyms:- 2,2'-(1-Methyl-2,6-Piperidinediyl)Diacetophenon
- 579-21-5
- 8,10-Diphenyllobelidione
- Ethanone, 2,2′-(1-methyl-2,6-piperidinediyl)bis[1-phenyl-, (2R,6S)-rel-
- Ethanone, 2,2′-(1-methyl-2,6-piperidinediyl)bis[1-phenyl-, cis-
- Lobelanine
- Shangengwantong
- ethanone, 2,2'-[(2R,6S)-1-methyl-2,6-piperidinediyl]bis[1-phenyl-
- meso-Lobelanine
- rel-(2R,6S)-2,2′-(1-Methyl-2,6-piperidinediyl)bis[1-phenylethanone]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2'-(1-Methyl-2,6-piperidinediyl)diacetophenon
CAS:Formula:C22H25NO2Purity:98%Molecular weight:335.4394Lobeline HCl EP Impurity B HCl
CAS:Formula:C22H25NO2·HClColor and Shape:White To Off-White SolidMolecular weight:335.45 36.46Lobelanine
CAS:Compound TCFN00444 is a useful organic compound for research related to life sciences. The catalog number is T131730 and the CAS number is 579-21-5.Formula:C22H25NO2Color and Shape:SoildMolecular weight:335.447Lobelanidine
CAS:Lobelanidine is a naturally occurring alkaloid, which is derived from the Lobelia genus of flowering plants. These plants are predominantly found in various regions such as North America and are known for their rich alkaloid content. Lobelanidine acts on the central nervous system by influencing neurotransmitter pathways, particularly involving dopamine and norepinephrine. Its molecular structure allows it to interact with receptors, potentially modulating synaptic transmission and influencing various neurological processes.Formula:C22H25NO2Purity:Min. 95%Molecular weight:335.4 g/mol





