CAS 579-64-6

2-(3-Chloro-2-methylphenoxy)acetic acid

Description:

2-(3-Chloro-2-methylphenoxy)acetic acid, with the CAS number 579-64-6, is a chemical compound that belongs to the class of phenoxyacetic acids. It is characterized by the presence of a chloro-substituted aromatic ring and an acetic acid functional group, which contributes to its properties as a herbicide. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents while exhibiting limited solubility in water. Its molecular structure allows it to interact with plant growth regulators, making it effective in controlling the growth of certain weeds. The compound is known for its selective herbicidal activity, targeting specific plant species while minimizing damage to desirable crops. Additionally, it has a moderate level of toxicity to aquatic organisms, necessitating careful handling and application. As with many chemical substances, safety precautions should be observed to mitigate any potential environmental impact or health risks associated with its use.

Formula: C₉H₉ClO₃

InChI: InChI=1S/C9H9ClO3/c1-6-7(10)3-2-4-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)

InChI key: InChIKey=GLSHQWWBXCWJDK-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=C(C)C(Cl)=CC=C1

Synonyms:

• 3-Chloro-2-methylphenoxyacetic acid
• Acetic acid, (3-chloro-2-methylphenoxy)-
• Acetic acid, [(3-chloro-o-tolyl)oxy]-
• Acetic acid, 2-(3-chloro-2-methylphenoxy)-
• 2-(3-Chloro-2-methylphenoxy)acetic acid

2-(3-Chloro-2-methylphenoxy)acetic acid

CAS: 579-64-6

2-(3-Chloro-2-methylphenoxy)acetic acid

Purity: 97%

Molecular weight: 200.62g/mol

Ref: 54-OR77895

2-(3-Chloro-2-methylphenoxy)acetic acid

CAS: 579-64-6

Purity: 97%

Molecular weight: 200.6199951

Ref: 10-F673537

2-(3-Chloro-2-methylphenoxy)acetic acid

CAS: 579-64-6

2-(3-Chloro-2-methylphenoxy)acetic acid is an alkali metal salt that is soluble in water. It has a centrosymmetric, symmetric and ligand environment. Its coordination number is 2. The crystallographic environment is anion, polymeric and dimeric. The crystal structure of 2-(3-chloro-2-methylphenoxy)acetic acid is a hydrated hydrogen bond polyhedra.

Formula: C₉H₉ClO₃

Purity: Min. 95%

Molecular weight: 200.62 g/mol

Ref: 3D-AAA57964