CAS 579-98-6

N-Acetyl-N-phenylglycine

Description:

N-Acetyl-N-phenylglycine, with the CAS number 579-98-6, is an organic compound that belongs to the class of amino acids and their derivatives. It features an acetyl group and a phenyl group attached to the nitrogen of the glycine structure, which contributes to its unique properties. This compound is typically a white to off-white crystalline solid, and it is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. N-Acetyl-N-phenylglycine is known for its potential applications in pharmaceuticals and as an intermediate in organic synthesis. Its structure allows for various interactions, making it useful in studies related to drug design and development. Additionally, it may exhibit biological activity, although specific pharmacological effects can vary and require further investigation. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1S/C10H11NO3/c1-8(12)11(7-10(13)14)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,13,14)

InChI key: InChIKey=SHXTZVXDUILKNY-UHFFFAOYSA-N

SMILES: N(CC(O)=O)(C(C)=O)C1=CC=CC=C1

Synonyms:

• [Acetyl(phenyl)amino]acetic acid
• Glycine, N-acetyl-N-phenyl-
• NSC 4555
• N-Acetyl-N-phenylglycine
• NSC 4016

2-(N-Phenylacetamido)acetic acid

CAS: 579-98-6

2-(N-Phenylacetamido)acetic acid is an alkyl ester that is synthesized by the reaction of acetyl chloride with toluene. This compound can be used as a pharmaceutical intermediate and a synthetic sweetener. The hydrogenation of 2-(N-phenylacetamido)acetic acid produces 2-(N-phenylacetamido)ethanoic acid, which has been shown to have antihypertensive effects. The p-toluenesulfonic acid is an acid catalyst that facilitates this reaction. The acetylation of 2-(N-phenylacetamido)acetic acid produces 2-(N-phenylacetamido)propionic acid, which has been used in the synthesis of rhodium. The reaction also results in a number of diastereoisomeric salts; these are stereoisomers that differ from each other because they are not mirror images of one another.

Formula: C₁₀H₁₁NO₃

Purity: Min. 95%

Molecular weight: 193.2 g/mol

Ref: 3D-AAA57998