CymitQuimica logo

CAS 57910-39-1

:

2-Propanol, 2-[(1,1-dimethylethyl)azo]-

Description:
2-Propanol, 2-[(1,1-dimethylethyl)azo]- is an organic compound characterized by the presence of a propanol group and an azo functional group. The compound features a branched alkyl group, specifically a tert-butyl group, attached to the azo linkage, which consists of a nitrogen-nitrogen double bond. This structure contributes to its unique chemical properties, including its potential as a solvent and its reactivity in various chemical reactions. The presence of the hydroxyl (-OH) group in the propanol portion indicates that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the azo group can undergo reduction reactions, making it useful in various synthetic applications. The compound is typically handled with care due to potential health hazards associated with azo compounds, which may include toxicity or carcinogenicity. Overall, 2-Propanol, 2-[(1,1-dimethylethyl)azo]- is a versatile chemical with applications in organic synthesis and industrial processes.
Formula:C7H16N2O
InChI:InChI=1S/C7H16N2O/c1-6(2,3)8-9-7(4,5)10/h10H,1-5H3
InChI key:InChIKey=LGKBMXVIXYRWDK-UHFFFAOYSA-N
SMILES:N(=NC(C)(C)O)C(C)(C)C
Synonyms:
  • 2-(2-tert-Butyldiazen-1-yl)propan-2-ol
  • 2-tert-Butylazo-2-hydroxypropane
  • 2-Propanol, 2-[(1,1-dimethylethyl)azo]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.