
CAS 57910-79-9
:2-[2-(1,1-Dimethylethyl)diazenyl]-2-butanol
Description:
2-[2-(1,1-Dimethylethyl)diazenyl]-2-butanol, with the CAS number 57910-79-9, is an organic compound characterized by its unique structure featuring a diazenyl group attached to a butanol backbone. This compound typically exhibits properties associated with both alcohols and azo compounds, including potential solubility in polar solvents due to the hydroxyl (-OH) group. The presence of the bulky tert-butyl group (1,1-dimethylethyl) can influence its steric hindrance and reactivity, potentially affecting its stability and interactions with other molecules. As an azo compound, it may also display color properties, which are common in such compounds, although specific color characteristics would depend on the overall molecular structure and environment. Additionally, the compound may participate in various chemical reactions typical of alcohols and azo compounds, including oxidation and reduction processes. Safety and handling considerations should be taken into account, as with many organic compounds, particularly those containing nitrogen.
Formula:C8H18N2O
InChI:InChI=1S/C8H18N2O/c1-6-8(5,11)10-9-7(2,3)4/h11H,6H2,1-5H3
InChI key:InChIKey=MNRAEINKZAECEF-UHFFFAOYSA-N
SMILES:C(N=NC(C)(C)C)(CC)(C)O
Synonyms:- 2-Butanol, 2-[(1,1-dimethylethyl)azo]-
- 2-[2-(1,1-Dimethylethyl)diazenyl]-2-butanol
- 2-tert-Butylazo-2-hydroxybutane
- 2-Butanol, 2-[2-(1,1-dimethylethyl)diazenyl]-
- 2-(tert-Butylazo)-2-butanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lucel 4
CAS:Lucel 4 is a bioactive chemical.Formula:C8H18N2OColor and Shape:SolidMolecular weight:158.245
