CymitQuimica logo

CAS 57930-95-7

:

20-Hydroxy-PGE2

Description:
20-Hydroxy-PGE2, also known as 20-hydroxyprostaglandin E2, is a naturally occurring prostaglandin derivative that plays a significant role in various physiological processes. It is characterized by its structure, which includes a cyclopentane ring and a carboxylic acid functional group, contributing to its biological activity. This compound is involved in the modulation of inflammation, regulation of blood flow, and the promotion of cell growth and differentiation. 20-Hydroxy-PGE2 is known to interact with specific receptors, influencing signaling pathways that affect cellular responses. Its synthesis occurs through enzymatic conversion of prostaglandin E2 (PGE2) by the action of specific enzymes, such as 15-hydroxyprostaglandin dehydrogenase. The compound is of interest in pharmacological research due to its potential therapeutic applications, particularly in the context of inflammatory diseases and cancer. Additionally, its stability and reactivity can vary depending on environmental conditions, making it a subject of study in both biochemical and medicinal chemistry.
Formula:C20H32O6
InChI:InChI=1S/C20H32O6/c21-13-7-3-4-8-15(22)11-12-17-16(18(23)14-19(17)24)9-5-1-2-6-10-20(25)26/h1,5,11-12,15-17,19,21-22,24H,2-4,6-10,13-14H2,(H,25,26)/b5-1-,12-11+/t15-,16+,17+,19+/m0/s1
InChI key:InChIKey=AZIGEYVZEVXWAD-NZGURKHLSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@@H]1[C@@H](/C=C/[C@H](CCCCCO)O)[C@H](O)CC1=O
Synonyms:
  • 20-Hydroxy-PGE2
  • Prosta-5,13-dien-1-oic acid, 11,15,20-trihydroxy-9-oxo-, (5Z,11α,13E,15S)-
  • (5Z,11α,13E,15S)-11,15,20-Trihydroxy-9-oxoprosta-5,13-dien-1-oic acid
  • 20-Hydroxyprostaglandin E2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.