CAS 57935-49-6
:Tiomergine
Description:
Tiomergine, with the CAS number 57935-49-6, is a chemical compound that belongs to the class of organosulfur compounds. It is primarily recognized for its use in the treatment of certain medical conditions, particularly in the context of its potential as a chelating agent for heavy metals. Tiomergine exhibits properties that allow it to bind to metal ions, facilitating their excretion from the body. The compound is characterized by its sulfur-containing structure, which contributes to its reactivity and interaction with various biological systems. Additionally, tiomergine has been studied for its pharmacological effects, including its role in detoxification processes. However, like many chemical substances, it may also have associated side effects and contraindications that necessitate careful consideration in therapeutic applications. Overall, tiomergine represents a significant interest in both medicinal chemistry and toxicology due to its unique properties and potential benefits in managing heavy metal toxicity.
Formula:C21H21N3S
InChI:InChI=1/C21H21N3S/c1-24-12-14(13-25-20-7-2-3-8-22-20)9-17-16-5-4-6-18-21(16)15(11-23-18)10-19(17)24/h2-9,11,14,19,23H,10,12-13H2,1H3/t14-,19-/m1/s1
Synonyms:- CF 25397
- Tiomergina
- (8beta)-6-methyl-8-[(pyridin-2-ylsulfanyl)methyl]-9,10-didehydroergoline
- Tiomergine [INN]
- UNII-85J22V47HN
- 9,10-Didehydro-6-methyl-8beta-((2-pyridylthio)methyl)ergoline
- 9,10-Didehydro-6-methyl-8 beta-(2-pyridylthiomethyl)ergoline
- Tiomerginum
- 6-methyl-8-[(pyridin-2-ylsulfanyl)methyl]-9,10-didehydroergoline
- Tiomergina [INN-Spanish]
- Tiomerginum [INN-Latin]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tiomergine
CAS:Tiomergine is a dopamine receptor agonist.Formula:C21H21N3SColor and Shape:SolidMolecular weight:347.48
