CAS 579476-63-4

2-Methylpyridine-4-boronic acid

Description:

2-Methylpyridine-4-boronic acid, with the CAS number 579476-63-4, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a methyl group at the second position of the pyridine ring and a boronic acid group at the fourth position, which contributes to its reactivity and utility in various chemical applications. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, making it useful in organic synthesis and medicinal chemistry. The boronic acid functionality allows for participation in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, 2-methylpyridine-4-boronic acid can act as a ligand in coordination chemistry and has potential applications in drug development due to its ability to interact with biological targets. Proper handling and storage are essential, as with many boronic acids, to maintain stability and prevent degradation.

Formula: C₆H₈BNO₃

InChI: InChI=1/C6H8BNO3/c1-5-4-6(2-3-8-5)11-7(9)10/h2-4,9-10H,1H3

SMILES: Cc1cc(ccn1)OB(O)O

Synonyms:

• (2-Methylpyridin-4-yl)boronic acid
• 2-Picoline-4-boronic acid
• (2-Methyl-4-Pyridyl)Oxyboronic Acid

2-Methylpyridine-4-boronic acid

CAS: 579476-63-4

Formula: C₆H₈BNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 136.9442

Ref: IN-DA003716

(2-Methylpyridin-4-yl)boronic Acid (contains varying amounts of Anhydride)

CAS: 579476-63-4

Formula: C₆H₈BNO₂

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 136.95

Ref: 3B-M2912

2-Methylpyridine-4-boronic acid

CAS: 579476-63-4

2-Methylpyridine-4-boronic acid

Formula: C₆H₈BNO₂

Purity: ≥95%

Color and Shape: white to off white solid

Molecular weight: 136.94g/mol

Ref: 54-OR2618

2-Methylpyridine-4-boronic acid

CAS: 579476-63-4

Formula: C₆H₈BNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 136.95

Ref: 10-F077975

2-Methylpyridine-4-boronic acid

CAS: 579476-63-4

2-Methylpyridine-4-boronic acid is a reactive molecule that has been used in post-column derivatization and vivo studies. It has been shown to be reactive with mass spectrometric analysis, cancer assays, proteomics, and tumorigenic sample preparation. It also has been shown to have a molecular target of the cytochrome P450 reductase (CPR), which is involved in the metabolism of drugs and other xenobiotics. 2-Methylpyridine-4-boronic acid binds to CPR and inhibits its enzymatic activity, thereby affecting the metabolism of xenobiotics.

Formula: C₆H₈BNO₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 136.94 g/mol

Ref: 3D-FM75225